C34H37F3N6O3 — CID 77108320
N-[3-(diethylamino)propyl]-4-methyl-3-[[4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzoyl]amino]benzamide (PubChem CID 77108320) has the molecular formula C34H37F3N6O3 and a molecular weight of 634.70 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-methyl-3-[[4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzoyl]amino]benzamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-methyl-3-[[4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 77108320 |
| Molecular Formula | C34H37F3N6O3 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-methyl-3-[[4-[[5-methyl-4-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]amino]benzoyl]amino]benzamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(C)c(NC(=O)c2ccc(Nc3ncc(C)c(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C34H37F3N6O3/c1-5-43(6-2)19-7-18-38-31(44)26-9-8-22(3)29(20-26)41-32(45)25-10-14-27(15-11-25)40-33-39-21-23(4)30(42-33)24-12-16-28(17-13-24)46-34(35,36)37/h8-17,20-21H,5-7,18-19H2,1-4H3,(H,38,44)(H,41,45)(H,39,40,42) |
| InChIKey | RANZZDUWPIZINS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|