C13H14F3N5O3 — CID 71791626
N-(3-methoxypropyl)-2-[4-(trifluoromethoxy)phenyl]tetrazole-5-carboxamide (PubChem CID 71791626) has the molecular formula C13H14F3N5O3 and a molecular weight of 345.28 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-(trifluoromethoxy)phenyl]tetrazole-5-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-(trifluoromethoxy)phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 71791626 |
| Molecular Formula | C13H14F3N5O3 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-(trifluoromethoxy)phenyl]tetrazole-5-carboxamide |
| SMILES | COCCCNC(=O)c1nnn(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H14F3N5O3/c1-23-8-2-7-17-12(22)11-18-20-21(19-11)9-3-5-10(6-4-9)24-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,22) |
| InChIKey | KVFLHTTXUDFVJW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|