C14H17ClN4O3 — CID 23608045
2-(4-chlorophenyl)-5-(hydroxymethyl)-N-(3-methoxypropyl)triazole-4-carboxamide (PubChem CID 23608045) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(hydroxymethyl)-N-(3-methoxypropyl)triazole-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-5-(hydroxymethyl)-N-(3-methoxypropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 23608045 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(hydroxymethyl)-N-(3-methoxypropyl)triazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1nn(-c2ccc(Cl)cc2)nc1CO |
| InChI | InChI=1S/C14H17ClN4O3/c1-22-8-2-7-16-14(21)13-12(9-20)17-19(18-13)11-5-3-10(15)4-6-11/h3-6,20H,2,7-9H2,1H3,(H,16,21) |
| InChIKey | JOXRWSXGKKNQAL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|