C17H24N4O3 — CID 23608156
N-(3-ethoxypropyl)-2-(4-ethylphenyl)-5-(hydroxymethyl)triazole-4-carboxamide (PubChem CID 23608156) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-(4-ethylphenyl)-5-(hydroxymethyl)triazole-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-2-(4-ethylphenyl)-5-(hydroxymethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 23608156 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-(3-ethoxypropyl)-2-(4-ethylphenyl)-5-(hydroxymethyl)triazole-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1nn(-c2ccc(CC)cc2)nc1CO |
| InChI | InChI=1S/C17H24N4O3/c1-3-13-6-8-14(9-7-13)21-19-15(12-22)16(20-21)17(23)18-10-5-11-24-4-2/h6-9,22H,3-5,10-12H2,1-2H3,(H,18,23) |
| InChIKey | DZJRYWXAPZJWBM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|