C18H20F3N3O2 — CID 66550469
N-[2-(dimethylamino)ethyl]-4-[4-(trifluoromethoxy)anilino]benzamide (PubChem CID 66550469) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[4-(trifluoromethoxy)anilino]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[4-(trifluoromethoxy)anilino]benzamide |
|---|---|
| PubChem CID | 66550469 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[4-(trifluoromethoxy)anilino]benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-24(2)12-11-22-17(25)13-3-5-14(6-4-13)23-15-7-9-16(10-8-15)26-18(19,20)21/h3-10,23H,11-12H2,1-2H3,(H,22,25) |
| InChIKey | FARHIFIXEBMFLL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |