C21H22FN5O — CID 143258543
6-ethanimidoyl-2-(4-fluorophenyl)-4-N-(4-methoxy-3-methylphenyl)-5-N-methylpyrimidine-4,5-diamine (PubChem CID 143258543) has the molecular formula C21H22FN5O and a molecular weight of 379.44 g/mol. Its IUPAC name is 6-ethanimidoyl-2-(4-fluorophenyl)-4-N-(4-methoxy-3-methylphenyl)-5-N-methylpyrimidine-4,5-diamine.
| Compound Name | 6-ethanimidoyl-2-(4-fluorophenyl)-4-N-(4-methoxy-3-methylphenyl)-5-N-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143258543 |
| Molecular Formula | C21H22FN5O |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 6-ethanimidoyl-2-(4-fluorophenyl)-4-N-(4-methoxy-3-methylphenyl)-5-N-methylpyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\C)c1nc(-c2ccc(F)cc2)nc(Nc2ccc(OC)c(C)c2)c1NC |
| InChI | InChI=1S/C21H22FN5O/c1-12-11-16(9-10-17(12)28-4)25-21-19(24-3)18(13(2)23)26-20(27-21)14-5-7-15(22)8-6-14/h5-11,23-24H,1-4H3,(H,25,26,27)/b23-13+ |
| InChIKey | OHDNXIBLTSTLOA-YDZHTSKRSA-N |
| XLogP | 4.77 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|