C18H18ClN5OS — CID 143258508
4-N-(3-chloro-4-methoxyphenyl)-6-ethanimidoyl-5-N-methyl-2-thiophen-2-ylpyrimidine-4,5-diamine (PubChem CID 143258508) has the molecular formula C18H18ClN5OS and a molecular weight of 387.90 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methoxyphenyl)-6-ethanimidoyl-5-N-methyl-2-thiophen-2-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-chloro-4-methoxyphenyl)-6-ethanimidoyl-5-N-methyl-2-thiophen-2-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143258508 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-N-(3-chloro-4-methoxyphenyl)-6-ethanimidoyl-5-N-methyl-2-thiophen-2-ylpyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\C)c1nc(-c2cccs2)nc(Nc2ccc(OC)c(Cl)c2)c1NC |
| InChI | InChI=1S/C18H18ClN5OS/c1-10(20)15-16(21-2)18(24-17(23-15)14-5-4-8-26-14)22-11-6-7-13(25-3)12(19)9-11/h4-9,20-21H,1-3H3,(H,22,23,24)/b20-10+ |
| InChIKey | JUUPMKIQQWDVAC-KEBDBYFISA-N |
| XLogP | 5.04 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|