C22H18F6N8O2 — CID 25261008
1-[4-[4-(trifluoromethoxy)anilino]-6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3,5-triazin-2-yl]piperazin-2-one (PubChem CID 25261008) has the molecular formula C22H18F6N8O2 and a molecular weight of 540.43 g/mol. Its IUPAC name is 1-[4-[4-(trifluoromethoxy)anilino]-6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3,5-triazin-2-yl]piperazin-2-one.
| Compound Name | 1-[4-[4-(trifluoromethoxy)anilino]-6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3,5-triazin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 25261008 |
| Molecular Formula | C22H18F6N8O2 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 1-[4-[4-(trifluoromethoxy)anilino]-6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-1,3,5-triazin-2-yl]piperazin-2-one |
| SMILES | O=C1CNCCN1c1nc(N/N=C/c2ccc(C(F)(F)F)cc2)nc(Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C22H18F6N8O2/c23-21(24,25)14-3-1-13(2-4-14)11-30-35-19-32-18(33-20(34-19)36-10-9-29-12-17(36)37)31-15-5-7-16(8-6-15)38-22(26,27)28/h1-8,11,29H,9-10,12H2,(H2,31,32,33,34,35)/b30-11+ |
| InChIKey | LELUEMGGIFSHGQ-KNBZMSCYSA-N |
| XLogP | 3.91 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|