C15H19F3N6O2 — CID 143789923
2-N-(2-methoxyethyl)-2-N,6-N-dimethyl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 143789923) has the molecular formula C15H19F3N6O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-2-N,6-N-dimethyl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2-methoxyethyl)-2-N,6-N-dimethyl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 143789923 |
| Molecular Formula | C15H19F3N6O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-N-(2-methoxyethyl)-2-N,6-N-dimethyl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(OC(F)(F)F)cc2)nc(N(C)CCOC)n1 |
| InChI | InChI=1S/C15H19F3N6O2/c1-19-12-21-13(23-14(22-12)24(2)8-9-25-3)20-10-4-6-11(7-5-10)26-15(16,17)18/h4-7H,8-9H2,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | WCQMTNZOCHAAIV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |