C34H38Cl2N10 — CID 101120335
4-N-[[3-[[[4-(4-tert-butylanilino)-6-chloro-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N-(4-tert-butylphenyl)-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 101120335) has the molecular formula C34H38Cl2N10 and a molecular weight of 657.65 g/mol. Its IUPAC name is 4-N-[[3-[[[4-(4-tert-butylanilino)-6-chloro-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N-(4-tert-butylphenyl)-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[[3-[[[4-(4-tert-butylanilino)-6-chloro-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N-(4-tert-butylphenyl)-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 101120335 |
| Molecular Formula | C34H38Cl2N10 |
| Molecular Weight | 657.65 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 4-N-[[3-[[[4-(4-tert-butylanilino)-6-chloro-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N-(4-tert-butylphenyl)-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)c1ccc(Nc2nc(Cl)nc(NCc3cccc(CNc4nc(Cl)nc(Nc5ccc(C(C)(C)C)cc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C34H38Cl2N10/c1-33(2,3)23-10-14-25(15-11-23)39-31-43-27(35)41-29(45-31)37-19-21-8-7-9-22(18-21)20-38-30-42-28(36)44-32(46-30)40-26-16-12-24(13-17-26)34(4,5)6/h7-18H,19-20H2,1-6H3,(H2,37,39,41,43,45)(H2,38,40,42,44,46) |
| InChIKey | PKKVAXTYGHLRNU-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |