C23H16ClF3N6O — CID 66679320
4-N-(5-chloro-2-pyridinyl)-6-phenyl-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine (PubChem CID 66679320) has the molecular formula C23H16ClF3N6O and a molecular weight of 484.87 g/mol. Its IUPAC name is 4-N-(5-chloro-2-pyridinyl)-6-phenyl-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-chloro-2-pyridinyl)-6-phenyl-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66679320 |
| Molecular Formula | C23H16ClF3N6O |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-N-(5-chloro-2-pyridinyl)-6-phenyl-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)Oc1ccc(C=NNc2nc(Nc3ccc(Cl)cn3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H16ClF3N6O/c24-17-8-11-20(28-14-17)31-21-12-19(16-4-2-1-3-5-16)30-22(32-21)33-29-13-15-6-9-18(10-7-15)34-23(25,26)27/h1-14H,(H2,28,30,31,32,33) |
| InChIKey | MIFCQZDHKKBRHT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|