C12H8ClF3N4 — CID 74397084
N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 74397084) has the molecular formula C12H8ClF3N4 and a molecular weight of 300.67 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 74397084 |
| Molecular Formula | C12H8ClF3N4 |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NN=Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H8ClF3N4/c13-9-3-1-8(2-4-9)7-18-20-11-17-6-5-10(19-11)12(14,15)16/h1-7H,(H,17,19,20) |
| InChIKey | QPKAWEMJYPPACR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|