C21H22Cl2N8O3 — CID 4065015
2-[[4,6-bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 4065015) has the molecular formula C21H22Cl2N8O3 and a molecular weight of 505.37 g/mol. Its IUPAC name is 2-[[4,6-bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[[4,6-bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 4065015 |
| Molecular Formula | C21H22Cl2N8O3 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 2-[[4,6-bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CO)Nc1nc(NN=Cc2ccc(Cl)cc2)nc(NN=Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H22Cl2N8O3/c22-16-5-1-14(2-6-16)9-24-30-19-26-18(29-21(11-32,12-33)13-34)27-20(28-19)31-25-10-15-3-7-17(23)8-4-15/h1-10,32-34H,11-13H2,(H3,26,27,28,29,30,31) |
| InChIKey | WPLAIQKPIPEMEL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 160.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|