C45H39N8O5S+ — CID 45281151
1-N,4-N-bis[[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate (PubChem CID 45281151) has the molecular formula C45H39N8O5S+ and a molecular weight of 803.93 g/mol. Its IUPAC name is 1-N,4-N-bis[[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate.
| Compound Name | 1-N,4-N-bis[[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45281151 |
| Molecular Formula | C45H39N8O5S+ |
| Molecular Weight | 803.93 g/mol |
| Exact Mass | 803.28 |
| IUPAC Name | 1-N,4-N-bis[[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]benzene-1,4-dicarboxamide;4-methylbenzenesulfonate |
| SMILES | C[n+]1c(-c2ccc(C=NNC(=O)c3ccc(C(=O)NN=Cc4ccc(-c5cn6ccccc6[n+]5C)cc4)cc3)cc2)cn2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C38H30N8O2.C7H8O3S/c1-43-33(25-45-21-5-3-7-35(43)45)29-13-9-27(10-14-29)23-39-41-37(47)31-17-19-32(20-18-31)38(48)42-40-24-28-11-15-30(16-12-28)34-26-46-22-6-4-8-36(46)44(34)2;1-6-2-4-7(5-3-6)11(8,9)10/h3-26H,1-2H3;2-5H,1H3,(H,8,9,10)/p+1 |
| InChIKey | GZDVTXZHQNWUEQ-UHFFFAOYSA-O |
| XLogP | 5.60 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.93 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|