C39H35N8O5S+ — CID 54608210
N,N'-bis[(E)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]oxamide;4-methylbenzenesulfonate (PubChem CID 54608210) has the molecular formula C39H35N8O5S+ and a molecular weight of 727.83 g/mol. Its IUPAC name is N,N'-bis[(E)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]oxamide;4-methylbenzenesulfonate.
| Compound Name | N,N'-bis[(E)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]oxamide;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54608210 |
| Molecular Formula | C39H35N8O5S+ |
| Molecular Weight | 727.83 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | N,N'-bis[(E)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]oxamide;4-methylbenzenesulfonate |
| SMILES | C[n+]1c(-c2ccc(/C=N/NC(=O)C(=O)N/N=C/c3ccc(-c4cn5ccccc5[n+]4C)cc3)cc2)cn2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C32H26N8O2.C7H8O3S/c1-37-27(21-39-17-5-3-7-29(37)39)25-13-9-23(10-14-25)19-33-35-31(41)32(42)36-34-20-24-11-15-26(16-12-24)28-22-40-18-6-4-8-30(40)38(28)2;1-6-2-4-7(5-3-6)11(8,9)10/h3-22H,1-2H3;2-5H,1H3,(H,8,9,10)/p+1/b33-19+,34-20+; |
| InChIKey | HBLDPRRLQKBPOH-IBHFGPSZSA-O |
| XLogP | 3.67 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|