C31H27Cl2N9+2 — CID 135484886
1,3-bis[(E)-[4-(6-chloro-1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]guanidine (PubChem CID 135484886) has the molecular formula C31H27Cl2N9+2 and a molecular weight of 596.53 g/mol. Its IUPAC name is 1,3-bis[(E)-[4-(6-chloro-1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]guanidine.
| Compound Name | 1,3-bis[(E)-[4-(6-chloro-1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 135484886 |
| Molecular Formula | C31H27Cl2N9+2 |
| Molecular Weight | 596.53 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 1,3-bis[(E)-[4-(6-chloro-1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]guanidine |
| SMILES | [H]N=C(N/N=C/c1ccc(-c2cn3cc(Cl)ccc3[n+]2C)cc1)N/N=C/c1ccc(-c2cn3cc(Cl)ccc3[n+]2C)cc1 |
| InChI | InChI=1S/C31H27Cl2N9/c1-39-27(19-41-17-25(32)11-13-29(39)41)23-7-3-21(4-8-23)15-35-37-31(34)38-36-16-22-5-9-24(10-6-22)28-20-42-18-26(33)12-14-30(42)40(28)2/h3-20H,1-2H3,(H3,34,37,38)/q+2/b35-15+,36-16+ |
| InChIKey | INNAAUBMHYEAAL-KTGRAOHMSA-N |
| XLogP | 4.96 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|