C17H16Cl3N5O — CID 173457720
N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]acetamide;hydrochloride (PubChem CID 173457720) has the molecular formula C17H16Cl3N5O and a molecular weight of 412.71 g/mol. Its IUPAC name is N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]acetamide;hydrochloride.
| Compound Name | N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 173457720 |
| Molecular Formula | C17H16Cl3N5O |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]acetamide;hydrochloride |
| SMILES | CC(=O)NC(=N/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H15Cl2N5O.ClH/c1-12(25)22-17(23-20-10-13-2-6-15(18)7-3-13)24-21-11-14-4-8-16(19)9-5-14;/h2-11H,1H3,(H2,22,23,24,25);1H/b20-10+,21-11+; |
| InChIKey | JUENTDZZOYKNHK-CUBOLJEZSA-N |
| XLogP | 3.86 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|