C23H18Cl3N5O2 — CID 135834221
N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methoxybenzamide (PubChem CID 135834221) has the molecular formula C23H18Cl3N5O2 and a molecular weight of 502.79 g/mol. Its IUPAC name is N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methoxybenzamide.
| Compound Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 135834221 |
| Molecular Formula | C23H18Cl3N5O2 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=N/N=C/c2ccc(Cl)cc2)N/N=C/c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C23H18Cl3N5O2/c1-33-21-11-6-17(12-20(21)26)22(32)29-23(30-27-13-15-2-7-18(24)8-3-15)31-28-14-16-4-9-19(25)10-5-16/h2-14H,1H3,(H2,29,30,31,32)/b27-13+,28-14+ |
| InChIKey | WWFKLDNTHCWXFJ-OCHFTUDZSA-N |
| XLogP | 5.40 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|