C22H16Cl2IN5O — CID 135834176
N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-iodobenzamide (PubChem CID 135834176) has the molecular formula C22H16Cl2IN5O and a molecular weight of 564.21 g/mol. Its IUPAC name is N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-iodobenzamide.
| Compound Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 135834176 |
| Molecular Formula | C22H16Cl2IN5O |
| Molecular Weight | 564.21 g/mol |
| Exact Mass | 562.98 |
| IUPAC Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-iodobenzamide |
| SMILES | O=C(N/C(=N/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C22H16Cl2IN5O/c23-18-7-1-15(2-8-18)13-26-29-22(28-21(31)17-5-11-20(25)12-6-17)30-27-14-16-3-9-19(24)10-4-16/h1-14H,(H2,28,29,30,31)/b26-13+,27-14+ |
| InChIKey | HJPDHHARHAVFHN-BMNRKXRESA-N |
| XLogP | 5.34 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.21 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|