C22H15Cl4N5O — CID 135834188
N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,4-dichlorobenzamide (PubChem CID 135834188) has the molecular formula C22H15Cl4N5O and a molecular weight of 507.21 g/mol. Its IUPAC name is N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,4-dichlorobenzamide.
| Compound Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 135834188 |
| Molecular Formula | C22H15Cl4N5O |
| Molecular Weight | 507.21 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | N-[(Z)-N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,4-dichlorobenzamide |
| SMILES | O=C(N/C(=N/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H15Cl4N5O/c23-16-5-1-14(2-6-16)12-27-30-22(31-28-13-15-3-7-17(24)8-4-15)29-21(32)19-10-9-18(25)11-20(19)26/h1-13H,(H2,29,30,31,32)/b27-12+,28-13+ |
| InChIKey | DCEAGDRGYCXREJ-ZDMXEENZSA-N |
| XLogP | 6.04 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.21 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|