C24H21Cl2N5O — CID 152752049
N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,3-dimethylbenzamide (PubChem CID 152752049) has the molecular formula C24H21Cl2N5O and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,3-dimethylbenzamide.
| Compound Name | N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 152752049 |
| Molecular Formula | C24H21Cl2N5O |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=NN=Cc2ccc(Cl)cc2)NN=Cc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C24H21Cl2N5O/c1-16-4-3-5-22(17(16)2)23(32)29-24(30-27-14-18-6-10-20(25)11-7-18)31-28-15-19-8-12-21(26)13-9-19/h3-15H,1-2H3,(H2,29,30,31,32) |
| InChIKey | BKFUWLYJLPJHQU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|