C28H29Cl2N5O2 — CID 152760572
N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-hexoxybenzamide (PubChem CID 152760572) has the molecular formula C28H29Cl2N5O2 and a molecular weight of 538.48 g/mol. Its IUPAC name is N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-hexoxybenzamide.
| Compound Name | N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 152760572 |
| Molecular Formula | C28H29Cl2N5O2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-[N,N'-bis[(4-chlorophenyl)methylideneamino]carbamimidoyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=NN=Cc2ccc(Cl)cc2)NN=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H29Cl2N5O2/c1-2-3-4-5-18-37-26-16-10-23(11-17-26)27(36)33-28(34-31-19-21-6-12-24(29)13-7-21)35-32-20-22-8-14-25(30)15-9-22/h6-17,19-20H,2-5,18H2,1H3,(H2,33,34,35,36) |
| InChIKey | NCDXPGKUJPFMBH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|