C23H18Cl3N5O — CID 173463123
N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methylbenzamide (PubChem CID 173463123) has the molecular formula C23H18Cl3N5O and a molecular weight of 486.79 g/mol. Its IUPAC name is N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methylbenzamide.
| Compound Name | N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 173463123 |
| Molecular Formula | C23H18Cl3N5O |
| Molecular Weight | 486.79 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[N,N'-bis[(E)-(4-chlorophenyl)methylideneamino]carbamimidoyl]-3-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=N/N=C/c2ccc(Cl)cc2)N/N=C/c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C23H18Cl3N5O/c1-15-2-7-18(12-21(15)26)22(32)29-23(30-27-13-16-3-8-19(24)9-4-16)31-28-14-17-5-10-20(25)11-6-17/h2-14H,1H3,(H2,29,30,31,32)/b27-13+,28-14+ |
| InChIKey | UZLSVOJRSWYXRV-OCHFTUDZSA-N |
| XLogP | 5.70 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|