C31H39ClN6 — CID 139267628
1,2,3-tris[(4-propan-2-ylphenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 139267628) has the molecular formula C31H39ClN6 and a molecular weight of 531.15 g/mol. Its IUPAC name is 1,2,3-tris[(4-propan-2-ylphenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2,3-tris[(4-propan-2-ylphenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 139267628 |
| Molecular Formula | C31H39ClN6 |
| Molecular Weight | 531.15 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1,2,3-tris[(4-propan-2-ylphenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | CC(C)c1ccc(C=NN=C(NN=Cc2ccc(C(C)C)cc2)NN=Cc2ccc(C(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C31H38N6.ClH/c1-22(2)28-13-7-25(8-14-28)19-32-35-31(36-33-20-26-9-15-29(16-10-26)23(3)4)37-34-21-27-11-17-30(18-12-27)24(5)6;/h7-24H,1-6H3,(H2,35,36,37);1H |
| InChIKey | QXZKIQOHOUZTET-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.15 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|