C29H33N5O2 — CID 5111295
2,6-dimethyl-3-N,5-N-bis[(4-propan-2-ylphenyl)methylideneamino]pyridine-3,5-dicarboxamide (PubChem CID 5111295) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 2,6-dimethyl-3-N,5-N-bis[(4-propan-2-ylphenyl)methylideneamino]pyridine-3,5-dicarboxamide.
| Compound Name | 2,6-dimethyl-3-N,5-N-bis[(4-propan-2-ylphenyl)methylideneamino]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 5111295 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2,6-dimethyl-3-N,5-N-bis[(4-propan-2-ylphenyl)methylideneamino]pyridine-3,5-dicarboxamide |
| SMILES | Cc1nc(C)c(C(=O)NN=Cc2ccc(C(C)C)cc2)cc1C(=O)NN=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H33N5O2/c1-18(2)24-11-7-22(8-12-24)16-30-33-28(35)26-15-27(21(6)32-20(26)5)29(36)34-31-17-23-9-13-25(14-10-23)19(3)4/h7-19H,1-6H3,(H,33,35)(H,34,36) |
| InChIKey | AYAVTBVLNQPYAW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|