C25H25N5O4 — CID 4860648
3-N,5-N-bis[(3-methoxyphenyl)methylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide (PubChem CID 4860648) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-N,5-N-bis[(3-methoxyphenyl)methylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[(3-methoxyphenyl)methylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4860648 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-N,5-N-bis[(3-methoxyphenyl)methylideneamino]-2,6-dimethylpyridine-3,5-dicarboxamide |
| SMILES | COc1cccc(C=NNC(=O)c2cc(C(=O)NN=Cc3cccc(OC)c3)c(C)nc2C)c1 |
| InChI | InChI=1S/C25H25N5O4/c1-16-22(24(31)29-26-14-18-7-5-9-20(11-18)33-3)13-23(17(2)28-16)25(32)30-27-15-19-8-6-10-21(12-19)34-4/h5-15H,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | YBJDEHAFJOYISP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|