C21H17N7O4 — CID 85033706
ethyl 4-[[5-[2-[(4-formylphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]benzoate (PubChem CID 85033706) has the molecular formula C21H17N7O4 and a molecular weight of 431.41 g/mol. Its IUPAC name is ethyl 4-[[5-[2-[(4-formylphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-[2-[(4-formylphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]benzoate |
|---|---|
| PubChem CID | 85033706 |
| Molecular Formula | C21H17N7O4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | ethyl 4-[[5-[2-[(4-formylphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc3nonc3nc2NN=Cc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C21H17N7O4/c1-2-31-21(30)15-7-9-16(10-8-15)23-17-18(25-20-19(24-17)27-32-28-20)26-22-11-13-3-5-14(12-29)6-4-13/h3-12H,2H2,1H3,(H,23,24,27)(H,25,26,28) |
| InChIKey | QVFDDYXVWSQTAS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|