C18H17N7O5 — CID 5160274
ethyl 4-[[12-(2-ethoxy-2-oxoethyl)-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-yl]amino]benzoate (PubChem CID 5160274) has the molecular formula C18H17N7O5 and a molecular weight of 411.38 g/mol. Its IUPAC name is ethyl 4-[[12-(2-ethoxy-2-oxoethyl)-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-yl]amino]benzoate.
| Compound Name | ethyl 4-[[12-(2-ethoxy-2-oxoethyl)-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-yl]amino]benzoate |
|---|---|
| PubChem CID | 5160274 |
| Molecular Formula | C18H17N7O5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl 4-[[12-(2-ethoxy-2-oxoethyl)-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-yl]amino]benzoate |
| SMILES | CCOC(=O)Cc1nnc2c(Nc3ccc(C(=O)OCC)cc3)nc3nonc3n12 |
| InChI | InChI=1S/C18H17N7O5/c1-3-28-13(26)9-12-21-22-16-14(20-15-17(25(12)16)24-30-23-15)19-11-7-5-10(6-8-11)18(27)29-4-2/h5-8H,3-4,9H2,1-2H3,(H,19,20,23) |
| InChIKey | BGEQEFHTDXTWEE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |