C16H16N4O3 — CID 52998633
ethyl 4-[(3-ethyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]benzoate (PubChem CID 52998633) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 4-[(3-ethyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]benzoate.
| Compound Name | ethyl 4-[(3-ethyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 52998633 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 4-[(3-ethyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc3onc(CC)c23)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-3-12-13-14(17-9-18-15(13)23-20-12)19-11-7-5-10(6-8-11)16(21)22-4-2/h5-9H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | ZMMUTKLRKIYRMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |