C16H11ClN3O2- — CID 135795392
2-chloro-5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]benzoate (PubChem CID 135795392) has the molecular formula C16H11ClN3O2- and a molecular weight of 312.74 g/mol. Its IUPAC name is 2-chloro-5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]benzoate.
| Compound Name | 2-chloro-5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135795392 |
| Molecular Formula | C16H11ClN3O2- |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-chloro-5-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]benzoate |
| SMILES | O=C([O-])c1cc(N/N=C/c2c[nH]c3ccccc23)ccc1Cl |
| InChI | InChI=1S/C16H12ClN3O2/c17-14-6-5-11(7-13(14)16(21)22)20-19-9-10-8-18-15-4-2-1-3-12(10)15/h1-9,18,20H,(H,21,22)/p-1/b19-9+ |
| InChIKey | PAJNKOSCHOIXQH-DJKKODMXSA-M |
| XLogP | 2.63 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|