C18H15ClN4O2 — CID 135684495
N-(3-chloro-4-methylphenyl)-N'-[(E)-1H-indol-3-ylmethylideneamino]oxamide (PubChem CID 135684495) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(E)-1H-indol-3-ylmethylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1H-indol-3-ylmethylideneamino]oxamide |
|---|---|
| PubChem CID | 135684495 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1H-indol-3-ylmethylideneamino]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C/c2c[nH]c3ccccc23)cc1Cl |
| InChI | InChI=1S/C18H15ClN4O2/c1-11-6-7-13(8-15(11)19)22-17(24)18(25)23-21-10-12-9-20-16-5-3-2-4-14(12)16/h2-10,20H,1H3,(H,22,24)(H,23,25)/b21-10+ |
| InChIKey | RBRKXRBRIMSADW-UFFVCSGVSA-N |
| XLogP | 3.22 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|