C21H16Cl4N2O — CID 19060225
N-[(E)-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 19060225) has the molecular formula C21H16Cl4N2O and a molecular weight of 454.18 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(E)-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 19060225 |
| Molecular Formula | C21H16Cl4N2O |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | N-[(E)-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | Clc1ccc(COc2ccc(Cl)cc2/C=N/NCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl4N2O/c22-16-6-4-14(5-7-16)13-28-21-9-8-17(23)10-15(21)11-26-27-12-18-19(24)2-1-3-20(18)25/h1-11,27H,12-13H2/b26-11+ |
| InChIKey | HTOLSFVFKFSFTA-KBKYJPHKSA-N |
| XLogP | 7.00 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|