C23H22ClIN2O3 — CID 133169121
N-[(E)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 133169121) has the molecular formula C23H22ClIN2O3 and a molecular weight of 536.80 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(E)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 133169121 |
| Molecular Formula | C23H22ClIN2O3 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | N-[(E)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C/c2cc(Cl)ccc2OCc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C23H22ClIN2O3/c1-28-22-9-5-17(11-23(22)29-2)13-26-27-14-18-12-19(24)6-10-21(18)30-15-16-3-7-20(25)8-4-16/h3-12,14,26H,13,15H2,1-2H3/b27-14+ |
| InChIKey | VCFKDQVCIDWULD-MZJWZYIUSA-N |
| XLogP | 5.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|