C22H20ClIN2O2 — CID 29148134
N-[(Z)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 29148134) has the molecular formula C22H20ClIN2O2 and a molecular weight of 506.77 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(Z)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 29148134 |
| Molecular Formula | C22H20ClIN2O2 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | N-[(Z)-[5-chloro-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C\c1cc(Cl)ccc1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C22H20ClIN2O2/c1-27-21-5-3-2-4-17(21)13-25-26-14-18-12-19(23)8-11-22(18)28-15-16-6-9-20(24)10-7-16/h2-12,14,25H,13,15H2,1H3/b26-14- |
| InChIKey | GWCXWMXVPFEZHW-WGARJPEWSA-N |
| XLogP | 5.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|