C30H32N4O5S — CID 126119445
2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126119445) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126119445 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(C)cc3)c2C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H32N4O5S/c1-21-11-13-26(14-12-21)34-22(2)17-24(23(34)3)19-31-32-30(35)20-33(25-9-7-6-8-10-25)40(36,37)27-15-16-28(38-4)29(18-27)39-5/h6-19H,20H2,1-5H3,(H,32,35)/b31-19- |
| InChIKey | IAOODRZUQKJOMQ-DXJNIWACSA-N |
| XLogP | 4.77 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|