C11H12N4OS3 — CID 6284233
2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(2-methylsulfanylthiophen-3-yl)methylideneamino]acetamide (PubChem CID 6284233) has the molecular formula C11H12N4OS3 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(2-methylsulfanylthiophen-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(2-methylsulfanylthiophen-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6284233 |
| Molecular Formula | C11H12N4OS3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(2-methylsulfanylthiophen-3-yl)methylideneamino]acetamide |
| SMILES | CSc1sccc1/C=N\NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C11H12N4OS3/c1-17-10-7(2-3-18-10)5-13-15-9(16)4-8-6-19-11(12)14-8/h2-3,5-6H,4H2,1H3,(H2,12,14)(H,15,16)/b13-5- |
| InChIKey | WBYMIGLZFJPCTD-ACAGNQJTSA-N |
| XLogP | 2.20 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|