C19H16Cl2N4O2S — CID 110338738
2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 110338738) has the molecular formula C19H16Cl2N4O2S and a molecular weight of 435.34 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 110338738 |
| Molecular Formula | C19H16Cl2N4O2S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-[4-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Nc1nc(CC(=O)N/N=C/c2ccc(OCc3c(Cl)cccc3Cl)cc2)cs1 |
| InChI | InChI=1S/C19H16Cl2N4O2S/c20-16-2-1-3-17(21)15(16)10-27-14-6-4-12(5-7-14)9-23-25-18(26)8-13-11-28-19(22)24-13/h1-7,9,11H,8,10H2,(H2,22,24)(H,25,26)/b23-9+ |
| InChIKey | GUVSKRDVFJFNGK-NUGSKGIGSA-N |
| XLogP | 4.30 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|