C26H23N3O4 — CID 2716307
2-hydroxy-N'-[2-(1H-indol-3-yl)-2-oxoacetyl]-2,2-bis(3-methylphenyl)acetohydrazide (PubChem CID 2716307) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-hydroxy-N'-[2-(1H-indol-3-yl)-2-oxoacetyl]-2,2-bis(3-methylphenyl)acetohydrazide.
| Compound Name | 2-hydroxy-N'-[2-(1H-indol-3-yl)-2-oxoacetyl]-2,2-bis(3-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 2716307 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-hydroxy-N'-[2-(1H-indol-3-yl)-2-oxoacetyl]-2,2-bis(3-methylphenyl)acetohydrazide |
| SMILES | Cc1cccc(C(O)(C(=O)NNC(=O)C(=O)c2c[nH]c3ccccc23)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-16-7-5-9-18(13-16)26(33,19-10-6-8-17(2)14-19)25(32)29-28-24(31)23(30)21-15-27-22-12-4-3-11-20(21)22/h3-15,27,33H,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | ZKBHXCXJSZKKLE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|