C25H28N2O2 — CID 1009881
2-hydroxy-2,2-bis(3-methylphenyl)-N'-[(1R)-1-(3-methylphenyl)ethyl]acetohydrazide (PubChem CID 1009881) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-hydroxy-2,2-bis(3-methylphenyl)-N'-[(1R)-1-(3-methylphenyl)ethyl]acetohydrazide.
| Compound Name | 2-hydroxy-2,2-bis(3-methylphenyl)-N'-[(1R)-1-(3-methylphenyl)ethyl]acetohydrazide |
|---|---|
| PubChem CID | 1009881 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-hydroxy-2,2-bis(3-methylphenyl)-N'-[(1R)-1-(3-methylphenyl)ethyl]acetohydrazide |
| SMILES | Cc1cccc([C@@H](C)NNC(=O)C(O)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C25H28N2O2/c1-17-8-5-11-21(14-17)20(4)26-27-24(28)25(29,22-12-6-9-18(2)15-22)23-13-7-10-19(3)16-23/h5-16,20,26,29H,1-4H3,(H,27,28)/t20-/m1/s1 |
| InChIKey | FBRFJWLCWWHQNO-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|