C23H24N2O2 — CID 4016272
2-hydroxy-N',2,2-tris(3-methylphenyl)acetohydrazide (PubChem CID 4016272) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-hydroxy-N',2,2-tris(3-methylphenyl)acetohydrazide.
| Compound Name | 2-hydroxy-N',2,2-tris(3-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 4016272 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-hydroxy-N',2,2-tris(3-methylphenyl)acetohydrazide |
| SMILES | Cc1cccc(NNC(=O)C(O)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-16-7-4-10-19(13-16)23(27,20-11-5-8-17(2)14-20)22(26)25-24-21-12-6-9-18(3)15-21/h4-15,24,27H,1-3H3,(H,25,26) |
| InChIKey | ZVZNCPRJPWBSJO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|