C21H20BrN3O2 — CID 1070867
N'-(5-bromo-2-pyridinyl)-2-hydroxy-2,2-bis(3-methylphenyl)acetohydrazide (PubChem CID 1070867) has the molecular formula C21H20BrN3O2 and a molecular weight of 426.31 g/mol. Its IUPAC name is N'-(5-bromo-2-pyridinyl)-2-hydroxy-2,2-bis(3-methylphenyl)acetohydrazide.
| Compound Name | N'-(5-bromo-2-pyridinyl)-2-hydroxy-2,2-bis(3-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 1070867 |
| Molecular Formula | C21H20BrN3O2 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N'-(5-bromo-2-pyridinyl)-2-hydroxy-2,2-bis(3-methylphenyl)acetohydrazide |
| SMILES | Cc1cccc(C(O)(C(=O)NNc2ccc(Br)cn2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H20BrN3O2/c1-14-5-3-7-16(11-14)21(27,17-8-4-6-15(2)12-17)20(26)25-24-19-10-9-18(22)13-23-19/h3-13,27H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | KUKBRPYDEMOIFF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|