C16H18N2O4 — CID 10040581
tert-butyl 2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]acetate (PubChem CID 10040581) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is tert-butyl 2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]acetate.
| Compound Name | tert-butyl 2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]acetate |
|---|---|
| PubChem CID | 10040581 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | tert-butyl 2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N2O4/c1-16(2,3)22-13(19)9-18-15(21)14(20)11-8-17-12-7-5-4-6-10(11)12/h4-8,17H,9H2,1-3H3,(H,18,21) |
| InChIKey | RBQYNSTYUHYBHQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|