C15H12N2O3 — CID 11630378
N-(furan-3-ylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 11630378) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-(furan-3-ylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 11630378 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(furan-3-ylmethyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | O=C(NCc1ccoc1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H12N2O3/c18-14(15(19)17-7-10-5-6-20-9-10)12-8-16-13-4-2-1-3-11(12)13/h1-6,8-9,16H,7H2,(H,17,19) |
| InChIKey | JQCAGVWXEVGACI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|