C20H14FN3O3 — CID 27370104
N-[[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 27370104) has the molecular formula C20H14FN3O3 and a molecular weight of 363.35 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 27370104 |
| Molecular Formula | C20H14FN3O3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[[5-(2-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | O=C(NCc1cc(-c2ccccc2F)on1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H14FN3O3/c21-16-7-3-1-6-14(16)18-9-12(24-27-18)10-23-20(26)19(25)15-11-22-17-8-4-2-5-13(15)17/h1-9,11,22H,10H2,(H,23,26) |
| InChIKey | QOGNPAIYCCOSPX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|