C27H23N5O2 — CID 171357197
N-[[1-[4-(4-ethylphenyl)phenyl]triazol-4-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 171357197) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[[1-[4-(4-ethylphenyl)phenyl]triazol-4-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[[1-[4-(4-ethylphenyl)phenyl]triazol-4-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 171357197 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[[1-[4-(4-ethylphenyl)phenyl]triazol-4-yl]methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CCc1ccc(-c2ccc(-n3cc(CNC(=O)C(=O)c4c[nH]c5ccccc45)nn3)cc2)cc1 |
| InChI | InChI=1S/C27H23N5O2/c1-2-18-7-9-19(10-8-18)20-11-13-22(14-12-20)32-17-21(30-31-32)15-29-27(34)26(33)24-16-28-25-6-4-3-5-23(24)25/h3-14,16-17,28H,2,15H2,1H3,(H,29,34) |
| InChIKey | JXDOWJBSORIEFU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|