C20H21ClN2O4S — CID 19188836
ethyl 4-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]benzoate (PubChem CID 19188836) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is ethyl 4-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]benzoate.
| Compound Name | ethyl 4-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19188836 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | ethyl 4-[4-(4-chlorophenoxy)butanoylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)CCCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-2-26-19(25)14-5-9-16(10-6-14)22-20(28)23-18(24)4-3-13-27-17-11-7-15(21)8-12-17/h5-12H,2-4,13H2,1H3,(H2,22,23,24,28) |
| InChIKey | WDGHFMRLCLMFKL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|