C21H19NO5S — CID 23848206
4-(4-ethoxyphenyl)-2-[(2-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 23848206) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-2-[(2-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-ethoxyphenyl)-2-[(2-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 23848206 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-(4-ethoxyphenyl)-2-[(2-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | CCOc1ccc(-c2csc(NC(=O)c3ccccc3OC)c2C(=O)O)cc1 |
| InChI | InChI=1S/C21H19NO5S/c1-3-27-14-10-8-13(9-11-14)16-12-28-20(18(16)21(24)25)22-19(23)15-6-4-5-7-17(15)26-2/h4-12H,3H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | JKZPBZVVSOGTMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|