C20H14Cl3NO4S — CID 87315341
4-(4-methylphenyl)-2-[(2,4,5-trichloro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 87315341) has the molecular formula C20H14Cl3NO4S and a molecular weight of 470.76 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[(2,4,5-trichloro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-methylphenyl)-2-[(2,4,5-trichloro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 87315341 |
| Molecular Formula | C20H14Cl3NO4S |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | 4-(4-methylphenyl)-2-[(2,4,5-trichloro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | COc1c(Cl)c(Cl)cc(C(=O)Nc2scc(-c3ccc(C)cc3)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C20H14Cl3NO4S/c1-9-3-5-10(6-4-9)12-8-29-19(14(12)20(26)27)24-18(25)11-7-13(21)16(23)17(28-2)15(11)22/h3-8H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | WQHAKMMMNMFEJC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|