C19H11Cl3INO4S — CID 87309931
4-(3-iodophenyl)-2-[(2,3,5-trichloro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 87309931) has the molecular formula C19H11Cl3INO4S and a molecular weight of 582.63 g/mol. Its IUPAC name is 4-(3-iodophenyl)-2-[(2,3,5-trichloro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(3-iodophenyl)-2-[(2,3,5-trichloro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 87309931 |
| Molecular Formula | C19H11Cl3INO4S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 580.85 |
| IUPAC Name | 4-(3-iodophenyl)-2-[(2,3,5-trichloro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | COc1c(Cl)cc(C(=O)Nc2scc(-c3cccc(I)c3)c2C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C19H11Cl3INO4S/c1-28-16-12(20)6-10(14(21)15(16)22)17(25)24-18-13(19(26)27)11(7-29-18)8-3-2-4-9(23)5-8/h2-7H,1H3,(H,24,25)(H,26,27) |
| InChIKey | UKJJFOJDBLYLDF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|