C26H22ClN3O4S — CID 4965712
2-(4-chloro-2,6-dimethylphenoxy)-N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4965712) has the molecular formula C26H22ClN3O4S and a molecular weight of 508.00 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4965712 |
| Molecular Formula | C26H22ClN3O4S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-(3-methylphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cccc(N(C(=O)COc2c(C)cc(Cl)cc2C)c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)c1 |
| InChI | InChI=1S/C26H22ClN3O4S/c1-16-5-4-6-22(11-16)29(24(31)14-34-25-17(2)12-20(27)13-18(25)3)26-28-23(15-35-26)19-7-9-21(10-8-19)30(32)33/h4-13,15H,14H2,1-3H3 |
| InChIKey | UICWJRAARLAYIO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|